Aniline and substituted anilines
Aobchem 5-Bromo-2 3-dichloroaniline | ≥95% | CAS 1377249-82-5 | C6H4BrCl2N | 5g
5-Bromo-2 3-dichloroaniline | ≥95% | CAS 1377249-82-5 | C6H4BrCl2N | 5g
Aobchem 4-Cyclopropyl-2-fluoroaniline | ≥95% | CAS 893739-89-4 | C9H10FN | 1g
4-Cyclopropyl-2-fluoroaniline | ≥95% | CAS 893739-89-4 | C9H10FN | 1g
Aobchem 4-Bromo-3 5-difluoroaniline | ≥97% | CAS 203302-95-8 | C6H4BrF2N | 10g
4-Bromo-3 5-difluoroaniline | ≥97% | CAS 203302-95-8 | C6H4BrF2N | 10g
Aobchem 2 6-Dibromo-4-isopropylphenol | ≥97% | CAS 2432-16-8 | C9H10Br2O | 100g
2 6-Dibromo-4-isopropylphenol | ≥97% | CAS 2432-16-8 | C9H10Br2O | 100g
Aobchem 3-(3 5-Dibromo-4-methylphenyl)oxetan-3-ol | 95% | C10H10Br2O2 | 500mg
3-(3 5-Dibromo-4-methylphenyl)oxetan-3-ol | 95% | C10H10Br2O2 | 500mg
Aobchem 2 4-Dibromo-5-(trifluoromethoxy)aniline | 97% | CAS 1806329-10-1 | C7H4Br2F3NO | 1g
2 4-Dibromo-5-(trifluoromethoxy)aniline | 97% | CAS 1806329-10-1 | C7H4Br2F3NO | 1g
Aobchem 2-Chloro-1-[3-(trifluoromethoxy)phenyl]ethanone | 95% | CAS 956831-25-7 | C9H6ClF3O2 | 250mg
2-Chloro-1-[3-(trifluoromethoxy)phenyl]ethanone | 95% | CAS 956831-25-7 | C9H6ClF3O2 | 250mg
Apexbio Technology LLC DuP 697 88149-94-4 50mg
DuP 697 (CAS 88149-94-4) is an ortho-diaryl heterocyclic compound that selectively and irreversibly inhibits cyclooxygenase-2 (COX-2) displaying an IC50 of 10 nM for human COX-2 and 800 nM for COX-1 DuP 697 is demonstrated to suppress prostaglandin synthesis and in vitro exhibits antiproliferative pro-apoptotic and anti-angiogenic effects in HT29 colorectal cancer cells (IC50 42 8 nM) This small molecule is commonly utilized to explore COX-2-mediated inflammatory pathways as well as tumor biology providing a valuable tool for dissecting mechanisms underlying inflammation and cancer
=O | 1g | 117530940](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502190533.JPG-250.jpg)
eMolecules 108485-08-1 | N-Ethyl 2-bromo-4-nitroaniline | Combi-Blocks | MFCD12044149 | 245.076 | C8H9BrN2O2 | 98.000 | CCNc1ccc(cc1Br)[N+]([O-])=O | 1g | 117530940
N-Ethyl 2-bromo-4-nitroaniline | Combi-Blocks | 108485-08-1 | MFCD12044149 | 245.076 | C8H9BrN2O2 | 98.000 | CCNc1ccc(cc1Br)[N+]([O-])=O | 1g | 117530940
eMolecules 106-40-1 | 4-Bromoaniline | AA Blocks LLC | MFCD00007822 | 172.025 | C6H6BrN | 0.000 | Nc1ccc(Br)cc1 | 5g | 414475994
4-Bromoaniline | AA Blocks LLC | 106-40-1 | MFCD00007822 | 172.025 | C6H6BrN | 0.000 | Nc1ccc(Br)cc1 | 5g | 414475994
eMolecules 461-82-5 | 4-(Trifluoromethoxy)aniline | Combi-Blocks, Inc. | MFCD00041314 | 177.126 | C7H6F3NO | 98.000 | Nc1ccc(OC(F)(F)F)cc1 | 25g | 866384098
4-(Trifluoromethoxy)aniline | Combi-Blocks, Inc. | 461-82-5 | MFCD00041314 | 177.126 | C7H6F3NO | 98.000 | Nc1ccc(OC(F)(F)F)cc1 | 25g | 866384098
Aobchem 2-Chloro-1-[2-(trifluoromethoxy)phenyl]ethanone | 95% | CAS 1214377-38-4 | C9H6ClF3O2 | 250mg
2-Chloro-1-[2-(trifluoromethoxy)phenyl]ethanone | 95% | CAS 1214377-38-4 | C9H6ClF3O2 | 250mg
Aobchem 3 6-Dibromo-2 4-diiodoaniline | 97% | CAS 618119-31-6 | C6H3Br2I2N | 250mg
3 6-Dibromo-2 4-diiodoaniline | 97% | CAS 618119-31-6 | C6H3Br2I2N | 250mg
Aobchem (3 4-Dibromo-2-methylphenyl)boronic acid | 97% | C7H7BBr2O2 | 500mg
(3 4-Dibromo-2-methylphenyl)boronic acid | 97% | C7H7BBr2O2 | 500mg